Products 137615-36-2
CAS 137615-36-2 is the registry number for 1-(4-(Benzyloxy)phenyl)-2,2,2-trifluoroethan-1-ol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2,2,2-trifluoro-1-(4-phenylmethoxyphenyl)ethanol (CAS 137615-36-2) is a chemical compound with the molecular formula C15H13F3O2 and a molecular weight of 282.26 g/mol. IUPAC name: 2,2,2-trifluoro-1-(4-phenylmethoxyphenyl)ethanol. InChIKey: VTKDFWOSQCKLGJ-UHFFFAOYSA-N.
| Molecular formula | C15H13F3O2 |
|---|---|
| Molecular weight | 282.26 g/mol |
| IUPAC name | 2,2,2-trifluoro-1-(4-phenylmethoxyphenyl)ethanol |
| InChIKey | VTKDFWOSQCKLGJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CC=C(C=C2)C(C(F)(F)F)O |
Computed by PubChem (NCBI)