CAS 1179354-65-4 appears in our catalog under these names: N-(7-(N-Methylmethylsulfonamido)-4-oxo-6-phenoxy-4H-chromen-3-yl)formamide, 98%, Iguratimod Impurity 26, Iguratimod Impurity 9, Iguratimod Impurity 5. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
N-[7-[methyl(methylsulfonyl)amino]-4-oxo-6-phenoxychromen-3-yl]formamide (CAS 1179354-65-4) is a chemical compound with the molecular formula C18H16N2O6S and a molecular weight of 388.4 g/mol. IUPAC name: N-[7-[methyl(methylsulfonyl)amino]-4-oxo-6-phenoxychromen-3-yl]formamide. InChIKey: KLDNNZDLIVGZTN-UHFFFAOYSA-N.
| Molecular formula | C18H16N2O6S |
|---|---|
| Molecular weight | 388.4 g/mol |
| IUPAC name | N-[7-[methyl(methylsulfonyl)amino]-4-oxo-6-phenoxychromen-3-yl]formamide |
| InChIKey | KLDNNZDLIVGZTN-UHFFFAOYSA-N |
| SMILES | CN(C1=C(C=C2C(=C1)OC=C(C2=O)NC=O)OC3=CC=CC=C3)S(=O)(=O)C |
Computed by PubChem (NCBI)