CAS 123663-50-3 appears in our catalog under these names: Iguratimod Impurity 41, Iguratimod Impurity 27, N-Methyl-N-(7-(methylsulfonamido)-4-oxo-6-phenoxy-4H-chromen-3-yl)formamide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
N-[7-(methanesulfonamido)-4-oxo-6-phenoxychromen-3-yl]-N-methylformamide (CAS 123663-50-3) is a chemical compound with the molecular formula C18H16N2O6S and a molecular weight of 388.4 g/mol. IUPAC name: N-[7-(methanesulfonamido)-4-oxo-6-phenoxychromen-3-yl]-N-methylformamide. InChIKey: PMJUZBWTGZOOGC-UHFFFAOYSA-N.
| Molecular formula | C18H16N2O6S |
|---|---|
| Molecular weight | 388.4 g/mol |
| IUPAC name | N-[7-(methanesulfonamido)-4-oxo-6-phenoxychromen-3-yl]-N-methylformamide |
| InChIKey | PMJUZBWTGZOOGC-UHFFFAOYSA-N |
| SMILES | CN(C=O)C1=COC2=CC(=C(C=C2C1=O)OC3=CC=CC=C3)NS(=O)(=O)C |
Computed by PubChem (NCBI)