CAS 123662-92-0 appears in our catalog under these names: Iguratimod Impurity 17, Iguratimod Impurity 2, N-(7-(Methylsulfonamido)-4-oxo-6-phenoxy-4H-chromen-3-yl)acetamide (Iguratimod Impurity), 97%, 97%, Ellamod impurity 2, 97.0%, Ellamod impurity 2 (Standard). Offered by: Chemat Brand, Chemat, MedChemExpress, Fluorochem. Available pack sizes: on request, 100mg, 250mg, 1g, 250 mg, 100 mg, 1 g, 500 mg.
N-[7-(methanesulfonamido)-4-oxo-6-phenoxychromen-3-yl]acetamide (CAS 123662-92-0) is a chemical compound with the molecular formula C18H16N2O6S and a molecular weight of 388.4 g/mol. IUPAC name: N-[7-(methanesulfonamido)-4-oxo-6-phenoxychromen-3-yl]acetamide. InChIKey: PPNKQUDDPQCNJK-UHFFFAOYSA-N.
| Molecular formula | C18H16N2O6S |
|---|---|
| Molecular weight | 388.4 g/mol |
| IUPAC name | N-[7-(methanesulfonamido)-4-oxo-6-phenoxychromen-3-yl]acetamide |
| InChIKey | PPNKQUDDPQCNJK-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=COC2=CC(=C(C=C2C1=O)OC3=CC=CC=C3)NS(=O)(=O)C |
Computed by PubChem (NCBI)