Products 3051691-31-4
CAS 3051691-31-4 is the registry number for 1,3-Dioxoisoindolin-2-yl tosylalaninate 95%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g.
(1,3-dioxoisoindol-2-yl) 2-[(4-methylphenyl)sulfonylamino]propanoate (CAS 3051691-31-4) is a chemical compound with the molecular formula C18H16N2O6S and a molecular weight of 388.4 g/mol. IUPAC name: (1,3-dioxoisoindol-2-yl) 2-[(4-methylphenyl)sulfonylamino]propanoate. InChIKey: IBZWTQBYSIGOTP-UHFFFAOYSA-N.
| Molecular formula | C18H16N2O6S |
|---|---|
| Molecular weight | 388.4 g/mol |
| IUPAC name | (1,3-dioxoisoindol-2-yl) 2-[(4-methylphenyl)sulfonylamino]propanoate |
| InChIKey | IBZWTQBYSIGOTP-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)NC(C)C(=O)ON2C(=O)C3=CC=CC=C3C2=O |
Computed by PubChem (NCBI)