CAS 1179370-94-5 appears in our catalog under these names: (5-(4-Chlorophenyl)-1,2,4-oxadiazol-3-yl)methanamine hydrochloride, 97%, 1-(5-(4-Chlorophenyl)-1,2,4-oxadiazol-3-yl)methanamine hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
[5-(4-chlorophenyl)-1,2,4-oxadiazol-3-yl]methanamine;hydrochloride (CAS 1179370-94-5) is a chemical compound with the molecular formula C9H9Cl2N3O and a molecular weight of 246.09 g/mol. IUPAC name: [5-(4-chlorophenyl)-1,2,4-oxadiazol-3-yl]methanamine;hydrochloride. InChIKey: XIBOMGJWOFGKBI-UHFFFAOYSA-N.
| Molecular formula | C9H9Cl2N3O |
|---|---|
| Molecular weight | 246.09 g/mol |
| IUPAC name | [5-(4-chlorophenyl)-1,2,4-oxadiazol-3-yl]methanamine;hydrochloride |
| InChIKey | XIBOMGJWOFGKBI-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NC(=NO2)CN)Cl.Cl |
Computed by PubChem (NCBI)