CAS 1217095-86-7 appears in our catalog under these names: ([3-(2-Chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl)amine hydrochloride, 95%, {(3-(2-chlorophenyl)-1,2,4-oxadiazol-5-yl)methyl}amine hydrochloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g.
[3-(2-chlorophenyl)-1,2,4-oxadiazol-5-yl]methanamine;hydrochloride (CAS 1217095-86-7) is a chemical compound with the molecular formula C9H9Cl2N3O and a molecular weight of 246.09 g/mol. IUPAC name: [3-(2-chlorophenyl)-1,2,4-oxadiazol-5-yl]methanamine;hydrochloride. InChIKey: JSKJDKPOOSXXKR-UHFFFAOYSA-N.
| Molecular formula | C9H9Cl2N3O |
|---|---|
| Molecular weight | 246.09 g/mol |
| IUPAC name | [3-(2-chlorophenyl)-1,2,4-oxadiazol-5-yl]methanamine;hydrochloride |
| InChIKey | JSKJDKPOOSXXKR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=NOC(=N2)CN)Cl.Cl |
Computed by PubChem (NCBI)