Products 1189988-05-3
CAS 1189988-05-3 is the registry number for 4-Hydroxy Clonidine-d4. Offered by: Chemat Brand, TRC, MedChemExpress. Available pack sizes: on request, 25mg, 1 mg, 10 mg.
3,5-dichloro-4-[(4,4,5,5-tetradeuterio-1H-imidazol-2-yl)amino]phenol (CAS 1189988-05-3) is a chemical compound with the molecular formula C9H9Cl2N3O and a molecular weight of 250.11 g/mol. IUPAC name: 3,5-dichloro-4-[(4,4,5,5-tetradeuterio-1H-imidazol-2-yl)amino]phenol. InChIKey: NTWBRPXHGAXREI-LNLMKGTHSA-N.
| Molecular formula | C9H9Cl2N3O |
|---|---|
| Molecular weight | 250.11 g/mol |
| IUPAC name | 3,5-dichloro-4-[(4,4,5,5-tetradeuterio-1H-imidazol-2-yl)amino]phenol |
| InChIKey | NTWBRPXHGAXREI-LNLMKGTHSA-N |
| SMILES | [2H]C1(C(N=C(N1)NC2=C(C=C(C=C2Cl)O)Cl)([2H])[2H])[2H] |
Computed by PubChem (NCBI)