CAS 1311318-12-3 is the registry number for (3-(4-Chlorophenyl)-1,2,4-oxadiazol-5-yl)methanamine hydrochloride. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]methanamine;hydrochloride (CAS 1311318-12-3) is a chemical compound with the molecular formula C9H9Cl2N3O and a molecular weight of 246.09 g/mol. IUPAC name: [3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]methanamine;hydrochloride. InChIKey: UABSHINLROSKHX-UHFFFAOYSA-N.
| Molecular formula | C9H9Cl2N3O |
|---|---|
| Molecular weight | 246.09 g/mol |
| IUPAC name | [3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]methanamine;hydrochloride |
| InChIKey | UABSHINLROSKHX-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NOC(=N2)CN)Cl.Cl |
Computed by PubChem (NCBI)