Products 1179474-10-2

CAS 1179474-10-2 is the registry number for Methyl 3-((1,1-dioxidotetrahydrothiophen-3-yl)amino)propanoate hydrochloride, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Methyl 3-[(1,1-dioxothiolan-3-yl)amino]propanoate;hydrochloride (CAS 1179474-10-2) is a chemical compound with the molecular formula C8H16ClNO4S and a molecular weight of 257.74 g/mol. IUPAC name: methyl 3-[(1,1-dioxothiolan-3-yl)amino]propanoate;hydrochloride. InChIKey: RIZGWILPUUAOFW-UHFFFAOYSA-N.

Identity
Molecular formulaC8H16ClNO4S
Molecular weight257.74 g/mol
IUPAC namemethyl 3-[(1,1-dioxothiolan-3-yl)amino]propanoate;hydrochloride
InChIKeyRIZGWILPUUAOFW-UHFFFAOYSA-N
SMILESCOC(=O)CCNC1CCS(=O)(=O)C1.Cl

Computed by PubChem (NCBI)