CAS 1803591-43-6 appears in our catalog under these names: 2-(4-(Aminomethyl)-1,1-dioxidotetrahydro-2H-thiopyran-4-yl)acetic acid hydrochloride, 97%, 2-(4-(Aminomethyl)-1,1-dioxidotetrahydro-2H-thiopyran-4-yl)acetic acid hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 0,5g, 50mg.
2-[4-(aminomethyl)-1,1-dioxothian-4-yl]acetic acid;hydrochloride (CAS 1803591-43-6) is a chemical compound with the molecular formula C8H16ClNO4S and a molecular weight of 257.74 g/mol. IUPAC name: 2-[4-(aminomethyl)-1,1-dioxothian-4-yl]acetic acid;hydrochloride. InChIKey: ASFKXAJJFFZPMS-UHFFFAOYSA-N.
| Molecular formula | C8H16ClNO4S |
|---|---|
| Molecular weight | 257.74 g/mol |
| IUPAC name | 2-[4-(aminomethyl)-1,1-dioxothian-4-yl]acetic acid;hydrochloride |
| InChIKey | ASFKXAJJFFZPMS-UHFFFAOYSA-N |
| SMILES | C1CS(=O)(=O)CCC1(CC(=O)O)CN.Cl |
Computed by PubChem (NCBI)