CAS 2260933-42-2 is the registry number for 4-(Aminomethyl)-5,5-dimethyl-1,1-dioxo-1λ6-thiolane-2-carboxylic acid hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
4-(aminomethyl)-5,5-dimethyl-1,1-dioxothiolane-2-carboxylic acid;hydrochloride (CAS 2260933-42-2) is a chemical compound with the molecular formula C8H16ClNO4S and a molecular weight of 257.74 g/mol. IUPAC name: 4-(aminomethyl)-5,5-dimethyl-1,1-dioxothiolane-2-carboxylic acid;hydrochloride. InChIKey: FWXMRGGOLUKNSO-UHFFFAOYSA-N.
| Molecular formula | C8H16ClNO4S |
|---|---|
| Molecular weight | 257.74 g/mol |
| IUPAC name | 4-(aminomethyl)-5,5-dimethyl-1,1-dioxothiolane-2-carboxylic acid;hydrochloride |
| InChIKey | FWXMRGGOLUKNSO-UHFFFAOYSA-N |
| SMILES | CC1(C(CC(S1(=O)=O)C(=O)O)CN)C.Cl |
Computed by PubChem (NCBI)