CAS 2734714-19-1 is the registry number for S-(2-(1-Methylethoxy)-2-oxoethyl)-L-cysteine Hydrochloride. Offered by: Mikromol. Available pack sizes: 25mg, 100mg.
(2R)-2-amino-3-(2-oxo-2-propan-2-yloxyethyl)sulfanylpropanoic acid;hydrochloride (CAS 2734714-19-1) is a chemical compound with the molecular formula C8H16ClNO4S and a molecular weight of 257.74 g/mol. IUPAC name: (2R)-2-amino-3-(2-oxo-2-propan-2-yloxyethyl)sulfanylpropanoic acid;hydrochloride. InChIKey: QAASQUQNPKMDDR-RGMNGODLSA-N.
| Molecular formula | C8H16ClNO4S |
|---|---|
| Molecular weight | 257.74 g/mol |
| IUPAC name | (2R)-2-amino-3-(2-oxo-2-propan-2-yloxyethyl)sulfanylpropanoic acid;hydrochloride |
| InChIKey | QAASQUQNPKMDDR-RGMNGODLSA-N |
| SMILES | CC(C)OC(=O)CSC[C@@H](C(=O)O)N.Cl |
Computed by PubChem (NCBI)