CAS 1179649-46-7 appears in our catalog under these names: 2-(3-Amino-1H-1,2,4-triazol-1-yl)-N-benzylacetamide, 95%, 2-(3-Amino-1H-1,2,4-triazol-1-yl)-N-benzylacetamide. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 2,5g, 250mg.
2-(3-amino-1,2,4-triazol-1-yl)-N-benzylacetamide (CAS 1179649-46-7) is a chemical compound with the molecular formula C11H13N5O and a molecular weight of 231.25 g/mol. IUPAC name: 2-(3-amino-1,2,4-triazol-1-yl)-N-benzylacetamide. InChIKey: KMQJEVYPTAVQNW-UHFFFAOYSA-N.
| Molecular formula | C11H13N5O |
|---|---|
| Molecular weight | 231.25 g/mol |
| IUPAC name | 2-(3-amino-1,2,4-triazol-1-yl)-N-benzylacetamide |
| InChIKey | KMQJEVYPTAVQNW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CNC(=O)CN2C=NC(=N2)N |
Computed by PubChem (NCBI)