CAS 1179732-72-9 appears in our catalog under these names: N-(2,2-Difluoroethyl)-2-(trifluoromethyl)aniline, 95%, N-(2,2-Difluoroethyl)-2-(trifluoromethyl)aniline. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
N-(2,2-difluoroethyl)-2-(trifluoromethyl)aniline (CAS 1179732-72-9) is a chemical compound with the molecular formula C9H8F5N and a molecular weight of 225.16 g/mol. IUPAC name: N-(2,2-difluoroethyl)-2-(trifluoromethyl)aniline. InChIKey: ZCNVRRRMBCAJMU-UHFFFAOYSA-N.
| Molecular formula | C9H8F5N |
|---|---|
| Molecular weight | 225.16 g/mol |
| IUPAC name | N-(2,2-difluoroethyl)-2-(trifluoromethyl)aniline |
| InChIKey | ZCNVRRRMBCAJMU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(F)(F)F)NCC(F)F |
Computed by PubChem (NCBI)