CAS 1821767-76-3 is the registry number for (S)-2,2-Difluoro-1-(3-(trifluoromethyl)phenyl)ethan-1-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(1S)-2,2-difluoro-1-[3-(trifluoromethyl)phenyl]ethanamine (CAS 1821767-76-3) is a chemical compound with the molecular formula C9H8F5N and a molecular weight of 225.16 g/mol. IUPAC name: (1S)-2,2-difluoro-1-[3-(trifluoromethyl)phenyl]ethanamine. InChIKey: WMEKOGNKRBECFX-ZETCQYMHSA-N.
| Molecular formula | C9H8F5N |
|---|---|
| Molecular weight | 225.16 g/mol |
| IUPAC name | (1S)-2,2-difluoro-1-[3-(trifluoromethyl)phenyl]ethanamine |
| InChIKey | WMEKOGNKRBECFX-ZETCQYMHSA-N |
| SMILES | C1=CC(=CC(=C1)C(F)(F)F)[C@@H](C(F)F)N |
Computed by PubChem (NCBI)