CAS 226979-96-0 is the registry number for 2-Methyl-4-(pentafluoroethyl)aniline. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
2-methyl-4-(1,1,2,2,2-pentafluoroethyl)aniline (CAS 226979-96-0) is a chemical compound with the molecular formula C9H8F5N and a molecular weight of 225.16 g/mol. IUPAC name: 2-methyl-4-(1,1,2,2,2-pentafluoroethyl)aniline. InChIKey: JVPHVEVTCAXTKN-UHFFFAOYSA-N.
| Molecular formula | C9H8F5N |
|---|---|
| Molecular weight | 225.16 g/mol |
| IUPAC name | 2-methyl-4-(1,1,2,2,2-pentafluoroethyl)aniline |
| InChIKey | JVPHVEVTCAXTKN-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)C(C(F)(F)F)(F)F)N |
Computed by PubChem (NCBI)