CAS 1270481-94-1 is the registry number for 1-(3-(Difluoromethyl)phenyl)-2,2,2-trifluoroethan-1-amine. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
1-[3-(difluoromethyl)phenyl]-2,2,2-trifluoroethanamine (CAS 1270481-94-1) is a chemical compound with the molecular formula C9H8F5N and a molecular weight of 225.16 g/mol. IUPAC name: 1-[3-(difluoromethyl)phenyl]-2,2,2-trifluoroethanamine. InChIKey: BHCISMUAKIWLHD-UHFFFAOYSA-N.
| Molecular formula | C9H8F5N |
|---|---|
| Molecular weight | 225.16 g/mol |
| IUPAC name | 1-[3-(difluoromethyl)phenyl]-2,2,2-trifluoroethanamine |
| InChIKey | BHCISMUAKIWLHD-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C(F)F)C(C(F)(F)F)N |
Computed by PubChem (NCBI)