Products 1179741-62-8
CAS 1179741-62-8 is the registry number for 2,5-Dimethyl-1-(1-methyl-1H-pyrazol-3-yl)-1H-pyrrole-3-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2,5-dimethyl-1-(1-methylpyrazol-3-yl)pyrrole-3-carboxylic acid (CAS 1179741-62-8) is a chemical compound with the molecular formula C11H13N3O2 and a molecular weight of 219.24 g/mol. IUPAC name: 2,5-dimethyl-1-(1-methylpyrazol-3-yl)pyrrole-3-carboxylic acid. InChIKey: PPIOIPPXESWTRF-UHFFFAOYSA-N.
| Molecular formula | C11H13N3O2 |
|---|---|
| Molecular weight | 219.24 g/mol |
| IUPAC name | 2,5-dimethyl-1-(1-methylpyrazol-3-yl)pyrrole-3-carboxylic acid |
| InChIKey | PPIOIPPXESWTRF-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(N1C2=NN(C=C2)C)C)C(=O)O |
Computed by PubChem (NCBI)