CAS 118006-64-7 is the registry number for 1,1,1-Trifluoro-3-phenylbutan-2-one. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
1,1,1-trifluoro-3-phenylbutan-2-one (CAS 118006-64-7) is a chemical compound with the molecular formula C10H9F3O and a molecular weight of 202.17 g/mol. IUPAC name: 1,1,1-trifluoro-3-phenylbutan-2-one. InChIKey: ZYVYQGWTGGGCTP-UHFFFAOYSA-N.
| Molecular formula | C10H9F3O |
|---|---|
| Molecular weight | 202.17 g/mol |
| IUPAC name | 1,1,1-trifluoro-3-phenylbutan-2-one |
| InChIKey | ZYVYQGWTGGGCTP-UHFFFAOYSA-N |
| SMILES | CC(C1=CC=CC=C1)C(=O)C(F)(F)F |
Computed by PubChem (NCBI)