CAS 118048-94-5 is the registry number for Eltrombopag Impurity 46. Offered by: Chemat Brand. Available pack sizes: on request.
2-(2,3-dimethylphenyl)-5-methyl-4H-pyrazol-3-one (CAS 118048-94-5) is a chemical compound with the molecular formula C12H14N2O and a molecular weight of 202.25 g/mol. IUPAC name: 2-(2,3-dimethylphenyl)-5-methyl-4H-pyrazol-3-one. InChIKey: HTMPABSJXGAEDU-UHFFFAOYSA-N.
| Molecular formula | C12H14N2O |
|---|---|
| Molecular weight | 202.25 g/mol |
| IUPAC name | 2-(2,3-dimethylphenyl)-5-methyl-4H-pyrazol-3-one |
| InChIKey | HTMPABSJXGAEDU-UHFFFAOYSA-N |
| SMILES | CC1=NN(C(=O)C1)C2=CC=CC(=C2C)C |
Computed by PubChem (NCBI)