CAS 1181394-66-0 appears in our catalog under these names: 2-Chloro-5,7-dimethylbenzo(d)oxazole, 95%, 2-Chloro-5,7-dimethyl-1,3-benzoxazole. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
2-chloro-5,7-dimethyl-1,3-benzoxazole (CAS 1181394-66-0) is a chemical compound with the molecular formula C9H8ClNO and a molecular weight of 181.62 g/mol. IUPAC name: 2-chloro-5,7-dimethyl-1,3-benzoxazole. InChIKey: PALSAEILDPHFJA-UHFFFAOYSA-N.
| Molecular formula | C9H8ClNO |
|---|---|
| Molecular weight | 181.62 g/mol |
| IUPAC name | 2-chloro-5,7-dimethyl-1,3-benzoxazole |
| InChIKey | PALSAEILDPHFJA-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C2C(=C1)N=C(O2)Cl)C |
Computed by PubChem (NCBI)