CAS 1181457-95-3 appears in our catalog under these names: 3-Amino-N-(2-(dimethylamino)ethyl)benzamide dihydrochloride, 3-Amino-N-(2-(dimethylamino)ethyl)benzamide dihydrochloride, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 1g, 100mg, 5g.
3-amino-N-[2-(dimethylamino)ethyl]benzamide;dihydrochloride (CAS 1181457-95-3) is a chemical compound with the molecular formula C11H19Cl2N3O and a molecular weight of 280.19 g/mol. IUPAC name: 3-amino-N-[2-(dimethylamino)ethyl]benzamide;dihydrochloride. InChIKey: CXWFDVYSMUQVLD-UHFFFAOYSA-N.
| Molecular formula | C11H19Cl2N3O |
|---|---|
| Molecular weight | 280.19 g/mol |
| IUPAC name | 3-amino-N-[2-(dimethylamino)ethyl]benzamide;dihydrochloride |
| InChIKey | CXWFDVYSMUQVLD-UHFFFAOYSA-N |
| SMILES | CN(C)CCNC(=O)C1=CC(=CC=C1)N.Cl.Cl |
Computed by PubChem (NCBI)