CAS 1286034-30-7 is the registry number for N1-(3-Amino-4-methylphenyl)-n2,n2-dimethylglycinamide dihydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 25g, 10g, 1g, 5g.
N-(3-amino-4-methylphenyl)-2-(dimethylamino)acetamide;dihydrochloride (CAS 1286034-30-7) is a chemical compound with the molecular formula C11H19Cl2N3O and a molecular weight of 280.19 g/mol. IUPAC name: N-(3-amino-4-methylphenyl)-2-(dimethylamino)acetamide;dihydrochloride. InChIKey: LJGGUZIBGXVRID-UHFFFAOYSA-N.
| Molecular formula | C11H19Cl2N3O |
|---|---|
| Molecular weight | 280.19 g/mol |
| IUPAC name | N-(3-amino-4-methylphenyl)-2-(dimethylamino)acetamide;dihydrochloride |
| InChIKey | LJGGUZIBGXVRID-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)NC(=O)CN(C)C)N.Cl.Cl |
Computed by PubChem (NCBI)