CAS 1269039-52-2 appears in our catalog under these names: N1-[4-(Dimethylamino)phenyl]-beta-alaninamide dihydrochloride, 95%, N~1~-(4-(dimethylamino)phenyl)-beta-alaninamide dihydrochloride, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 1g.
3-amino-N-[4-(dimethylamino)phenyl]propanamide;dihydrochloride (CAS 1269039-52-2) is a chemical compound with the molecular formula C11H19Cl2N3O and a molecular weight of 280.19 g/mol. IUPAC name: 3-amino-N-[4-(dimethylamino)phenyl]propanamide;dihydrochloride. InChIKey: JMZNWRBOLXPBDA-UHFFFAOYSA-N.
| Molecular formula | C11H19Cl2N3O |
|---|---|
| Molecular weight | 280.19 g/mol |
| IUPAC name | 3-amino-N-[4-(dimethylamino)phenyl]propanamide;dihydrochloride |
| InChIKey | JMZNWRBOLXPBDA-UHFFFAOYSA-N |
| SMILES | CN(C)C1=CC=C(C=C1)NC(=O)CCN.Cl.Cl |
Computed by PubChem (NCBI)