Products 1803586-69-7
CAS 1803586-69-7 is the registry number for 6-(2,6-Dimethylmorpholin-4-yl)pyridin-3-amine dihydrochloride. Offered by: Biosynth. Available pack sizes: 5g, 0,5g.
6-(2,6-dimethylmorpholin-4-yl)pyridin-3-amine;dihydrochloride (CAS 1803586-69-7) is a chemical compound with the molecular formula C11H19Cl2N3O and a molecular weight of 280.19 g/mol. IUPAC name: 6-(2,6-dimethylmorpholin-4-yl)pyridin-3-amine;dihydrochloride. InChIKey: MGTAMNDBJSINTP-UHFFFAOYSA-N.
| Molecular formula | C11H19Cl2N3O |
|---|---|
| Molecular weight | 280.19 g/mol |
| IUPAC name | 6-(2,6-dimethylmorpholin-4-yl)pyridin-3-amine;dihydrochloride |
| InChIKey | MGTAMNDBJSINTP-UHFFFAOYSA-N |
| SMILES | CC1CN(CC(O1)C)C2=NC=C(C=C2)N.Cl.Cl |
Computed by PubChem (NCBI)