Products 1181458-10-5
CAS 1181458-10-5 appears in our catalog under these names: 3-(Cyanomethyl)benzamide, 95%, 3-(Cyanomethyl)benzamide, 3-(Cyanomethyl)benzamide, 98%, 98%, 3-(Cyanomethyl)benzamide, 98%. Offered by: Combi-blocks, Biosynth, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 0,5g, 50mg.
3-(cyanomethyl)benzamide (CAS 1181458-10-5) is a chemical compound with the molecular formula C9H8N2O and a molecular weight of 160.17 g/mol. IUPAC name: 3-(cyanomethyl)benzamide. InChIKey: DPYRAILBOJTIRV-UHFFFAOYSA-N.
| Molecular formula | C9H8N2O |
|---|---|
| Molecular weight | 160.17 g/mol |
| IUPAC name | 3-(cyanomethyl)benzamide |
| InChIKey | DPYRAILBOJTIRV-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C(=O)N)CC#N |
Computed by PubChem (NCBI)