CAS 118176-26-4 appears in our catalog under these names: (2R,3S)-4-(Quinoxalin-2-yl)butane-1,2,3-triol, 98%, (2R,3S)-4-(2-Quinoxalinyl)-1,2,3-butanetriol, >95% (HPLC). Offered by: Chemat Brand, TRC. Available pack sizes: on request, 10mg, 25mg, 5mg.
(2R,3S)-4-quinoxalin-2-ylbutane-1,2,3-triol (CAS 118176-26-4) is a chemical compound with the molecular formula C12H14N2O3 and a molecular weight of 234.25 g/mol. IUPAC name: (2R,3S)-4-quinoxalin-2-ylbutane-1,2,3-triol. InChIKey: KFKHJQAEESRVHL-NWDGAFQWSA-N.
| Molecular formula | C12H14N2O3 |
|---|---|
| Molecular weight | 234.25 g/mol |
| IUPAC name | (2R,3S)-4-quinoxalin-2-ylbutane-1,2,3-triol |
| InChIKey | KFKHJQAEESRVHL-NWDGAFQWSA-N |
| SMILES | C1=CC=C2C(=C1)N=CC(=N2)C[C@@H]([C@@H](CO)O)O |
Computed by PubChem (NCBI)