Products 1181817-76-4
CAS 1181817-76-4 is the registry number for (S)-1-(3,5-Difluorophenyl)but-3-en-1-amine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(1S)-1-(3,5-difluorophenyl)but-3-en-1-amine (CAS 1181817-76-4) is a chemical compound with the molecular formula C10H11F2N and a molecular weight of 183.20 g/mol. IUPAC name: (1S)-1-(3,5-difluorophenyl)but-3-en-1-amine. InChIKey: FFWOTYXWHGHMMS-JTQLQIEISA-N.
| Molecular formula | C10H11F2N |
|---|---|
| Molecular weight | 183.20 g/mol |
| IUPAC name | (1S)-1-(3,5-difluorophenyl)but-3-en-1-amine |
| InChIKey | FFWOTYXWHGHMMS-JTQLQIEISA-N |
| SMILES | C=CC[C@@H](C1=CC(=CC(=C1)F)F)N |
Computed by PubChem (NCBI)