Products 1270203-83-2
CAS 1270203-83-2 is the registry number for (R)-1-(3,5-Difluorophenyl)but-3-en-1-amine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(1R)-1-(3,5-difluorophenyl)but-3-en-1-amine (CAS 1270203-83-2) is a chemical compound with the molecular formula C10H11F2N and a molecular weight of 183.20 g/mol. IUPAC name: (1R)-1-(3,5-difluorophenyl)but-3-en-1-amine. InChIKey: FFWOTYXWHGHMMS-SNVBAGLBSA-N.
| Molecular formula | C10H11F2N |
|---|---|
| Molecular weight | 183.20 g/mol |
| IUPAC name | (1R)-1-(3,5-difluorophenyl)but-3-en-1-amine |
| InChIKey | FFWOTYXWHGHMMS-SNVBAGLBSA-N |
| SMILES | C=CC[C@H](C1=CC(=CC(=C1)F)F)N |
Computed by PubChem (NCBI)