Products 1181894-93-8
CAS 1181894-93-8 is the registry number for 4-Acetyl-5-methyl-3-propyl-1H-pyrrole-2-carboxylic acid. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
4-acetyl-5-methyl-3-propyl-1H-pyrrole-2-carboxylic acid (CAS 1181894-93-8) is a chemical compound with the molecular formula C11H15NO3 and a molecular weight of 209.24 g/mol. IUPAC name: 4-acetyl-5-methyl-3-propyl-1H-pyrrole-2-carboxylic acid. InChIKey: DAQAQWGFAZEZLJ-UHFFFAOYSA-N.
| Molecular formula | C11H15NO3 |
|---|---|
| Molecular weight | 209.24 g/mol |
| IUPAC name | 4-acetyl-5-methyl-3-propyl-1H-pyrrole-2-carboxylic acid |
| InChIKey | DAQAQWGFAZEZLJ-UHFFFAOYSA-N |
| SMILES | CCCC1=C(NC(=C1C(=O)C)C)C(=O)O |
Computed by PubChem (NCBI)