CAS 1182447-14-8 appears in our catalog under these names: 4-Chloro-2-(3-cyclopentyl-1,2,4-oxadiazol-5-yl)aniline, 95%, 4-Chloro-2-(3-cyclopentyl-1,2,4-oxadiazol-5-yl)aniline. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
4-chloro-2-(3-cyclopentyl-1,2,4-oxadiazol-5-yl)aniline (CAS 1182447-14-8) is a chemical compound with the molecular formula C13H14ClN3O and a molecular weight of 263.72 g/mol. IUPAC name: 4-chloro-2-(3-cyclopentyl-1,2,4-oxadiazol-5-yl)aniline. InChIKey: ZTUOEBCSFVHMCP-UHFFFAOYSA-N.
| Molecular formula | C13H14ClN3O |
|---|---|
| Molecular weight | 263.72 g/mol |
| IUPAC name | 4-chloro-2-(3-cyclopentyl-1,2,4-oxadiazol-5-yl)aniline |
| InChIKey | ZTUOEBCSFVHMCP-UHFFFAOYSA-N |
| SMILES | C1CCC(C1)C2=NOC(=N2)C3=C(C=CC(=C3)Cl)N |
Computed by PubChem (NCBI)