Products 118264-04-3
CAS 118264-04-3 appears in our catalog under these names: 6-Phenylazaperhydroine-2,4-dione, 95%, 6-Phenylpiperidine-2,4-dione, 95-<97%, 6-Phenylpiperidine-2,4-dione, ≥97-<99%, 6–Phenylpiperidine–2，4–dione, 6-Phenylazaperhydroine-2,4-dione. Offered by: Combi-blocks, Hoffman Fine Chemicals, GLPBio, Biosynth, Chemat. Available pack sizes: 1g, 250mg, 100mg, 10g, 25g, 50g, 100g, 200g.
6-phenylpiperidine-2,4-dione (CAS 118264-04-3) is a chemical compound with the molecular formula C11H11NO2 and a molecular weight of 189.21 g/mol. IUPAC name: 6-phenylpiperidine-2,4-dione. InChIKey: IBYLHJWZATWPEB-UHFFFAOYSA-N.
| Molecular formula | C11H11NO2 |
|---|---|
| Molecular weight | 189.21 g/mol |
| IUPAC name | 6-phenylpiperidine-2,4-dione |
| InChIKey | IBYLHJWZATWPEB-UHFFFAOYSA-N |
| SMILES | C1C(NC(=O)CC1=O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)