CAS 118266-02-7 is the registry number for N-(2,4-Difluoro-5-nitrophenyl)acetamide, 95+%. Offered by: AmBeed. Available pack sizes: 1g.
N-(2,4-difluoro-5-nitrophenyl)acetamide (CAS 118266-02-7) is a chemical compound with the molecular formula C8H6F2N2O3 and a molecular weight of 216.14 g/mol. IUPAC name: N-(2,4-difluoro-5-nitrophenyl)acetamide. InChIKey: ROTRYCVIIHNNIR-UHFFFAOYSA-N.
| Molecular formula | C8H6F2N2O3 |
|---|---|
| Molecular weight | 216.14 g/mol |
| IUPAC name | N-(2,4-difluoro-5-nitrophenyl)acetamide |
| InChIKey | ROTRYCVIIHNNIR-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=CC(=C(C=C1F)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)