Products 1342427-94-4
CAS 1342427-94-4 is the registry number for 2-(Carbamoylamino)-4,5-difluorobenzoic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-(carbamoylamino)-4,5-difluorobenzoic acid (CAS 1342427-94-4) is a chemical compound with the molecular formula C8H6F2N2O3 and a molecular weight of 216.14 g/mol. IUPAC name: 2-(carbamoylamino)-4,5-difluorobenzoic acid. InChIKey: HMTJGFAOAICJMM-UHFFFAOYSA-N.
| Molecular formula | C8H6F2N2O3 |
|---|---|
| Molecular weight | 216.14 g/mol |
| IUPAC name | 2-(carbamoylamino)-4,5-difluorobenzoic acid |
| InChIKey | HMTJGFAOAICJMM-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1F)F)NC(=O)N)C(=O)O |
Computed by PubChem (NCBI)