CAS 441-30-5 appears in our catalog under these names: N-(2,4-Difluoro-6-nitrophenyl)acetamide, 95%, N-(2,4-Difluoro-6-nitrophenyl)acetamide. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
N-(2,4-difluoro-6-nitrophenyl)acetamide (CAS 441-30-5) is a chemical compound with the molecular formula C8H6F2N2O3 and a molecular weight of 216.14 g/mol. IUPAC name: N-(2,4-difluoro-6-nitrophenyl)acetamide. InChIKey: ZBECJQMWJBFRCL-UHFFFAOYSA-N.
| Molecular formula | C8H6F2N2O3 |
|---|---|
| Molecular weight | 216.14 g/mol |
| IUPAC name | N-(2,4-difluoro-6-nitrophenyl)acetamide |
| InChIKey | ZBECJQMWJBFRCL-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=C(C=C(C=C1F)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)