CAS 1182937-89-8 is the registry number for 5-Chloro-2-(2,2-difluoroethoxy)benzoic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
5-chloro-2-(2,2-difluoroethoxy)benzoic acid (CAS 1182937-89-8) is a chemical compound with the molecular formula C9H7ClF2O3 and a molecular weight of 236.60 g/mol. IUPAC name: 5-chloro-2-(2,2-difluoroethoxy)benzoic acid. InChIKey: FEIYDGGLGPHJJM-UHFFFAOYSA-N.
| Molecular formula | C9H7ClF2O3 |
|---|---|
| Molecular weight | 236.60 g/mol |
| IUPAC name | 5-chloro-2-(2,2-difluoroethoxy)benzoic acid |
| InChIKey | FEIYDGGLGPHJJM-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)C(=O)O)OCC(F)F |
Computed by PubChem (NCBI)