Products 1250734-08-7

CAS 1250734-08-7 is the registry number for 3-(2-Chlorophenyl)-2,2-difluoro-3-hydroxypropanoic Acid (Mixture of Diastereomers). Offered by: TRC. Available pack sizes: 5g.

Structural formula: {0} (CAS {1})

3-(2-chlorophenyl)-2,2-difluoro-3-hydroxypropanoic acid (CAS 1250734-08-7) is a chemical compound with the molecular formula C9H7ClF2O3 and a molecular weight of 236.60 g/mol. IUPAC name: 3-(2-chlorophenyl)-2,2-difluoro-3-hydroxypropanoic acid. InChIKey: QKUUKOJMCCZJQC-UHFFFAOYSA-N.

Identity
Molecular formulaC9H7ClF2O3
Molecular weight236.60 g/mol
IUPAC name3-(2-chlorophenyl)-2,2-difluoro-3-hydroxypropanoic acid
InChIKeyQKUUKOJMCCZJQC-UHFFFAOYSA-N
SMILESC1=CC=C(C(=C1)C(C(C(=O)O)(F)F)O)Cl

Computed by PubChem (NCBI)