CAS 1250734-08-7 is the registry number for 3-(2-Chlorophenyl)-2,2-difluoro-3-hydroxypropanoic Acid (Mixture of Diastereomers). Offered by: TRC. Available pack sizes: 5g.
3-(2-chlorophenyl)-2,2-difluoro-3-hydroxypropanoic acid (CAS 1250734-08-7) is a chemical compound with the molecular formula C9H7ClF2O3 and a molecular weight of 236.60 g/mol. IUPAC name: 3-(2-chlorophenyl)-2,2-difluoro-3-hydroxypropanoic acid. InChIKey: QKUUKOJMCCZJQC-UHFFFAOYSA-N.
| Molecular formula | C9H7ClF2O3 |
|---|---|
| Molecular weight | 236.60 g/mol |
| IUPAC name | 3-(2-chlorophenyl)-2,2-difluoro-3-hydroxypropanoic acid |
| InChIKey | QKUUKOJMCCZJQC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(C(C(=O)O)(F)F)O)Cl |
Computed by PubChem (NCBI)