CAS 2354591-81-2 is the registry number for 2-(2-Chloro-5-methoxyphenyl)-2,2-difluoroacetic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(2-chloro-5-methoxyphenyl)-2,2-difluoroacetic acid (CAS 2354591-81-2) is a chemical compound with the molecular formula C9H7ClF2O3 and a molecular weight of 236.60 g/mol. IUPAC name: 2-(2-chloro-5-methoxyphenyl)-2,2-difluoroacetic acid. InChIKey: OJKKQDFACBYUND-UHFFFAOYSA-N.
| Molecular formula | C9H7ClF2O3 |
|---|---|
| Molecular weight | 236.60 g/mol |
| IUPAC name | 2-(2-chloro-5-methoxyphenyl)-2,2-difluoroacetic acid |
| InChIKey | OJKKQDFACBYUND-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1)Cl)C(C(=O)O)(F)F |
Computed by PubChem (NCBI)