CAS 1824286-08-9 appears in our catalog under these names: Moxifloxacin Impurity 101, Moxifloxacin Impurity 63. Offered by: Chemat Brand. Available pack sizes: on request.
2,4-difluoro-3,5-dimethoxybenzoyl chloride (CAS 1824286-08-9) is a chemical compound with the molecular formula C9H7ClF2O3 and a molecular weight of 236.60 g/mol. IUPAC name: 2,4-difluoro-3,5-dimethoxybenzoyl chloride. InChIKey: FASBSPHKXYQOJX-UHFFFAOYSA-N.
| Molecular formula | C9H7ClF2O3 |
|---|---|
| Molecular weight | 236.60 g/mol |
| IUPAC name | 2,4-difluoro-3,5-dimethoxybenzoyl chloride |
| InChIKey | FASBSPHKXYQOJX-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=C(C(=C1)C(=O)Cl)F)OC)F |
Computed by PubChem (NCBI)