Products 1183213-07-1
CAS 1183213-07-1 is the registry number for 1-(5-Aminopyridin-2-yl)-3-phenyl-4,5-dihydro-1H-pyrazol-5-one. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-(5-amino-2-pyridinyl)-5-phenyl-4H-pyrazol-3-one (CAS 1183213-07-1) is a chemical compound with the molecular formula C14H12N4O and a molecular weight of 252.27 g/mol. IUPAC name: 2-(5-amino-2-pyridinyl)-5-phenyl-4H-pyrazol-3-one. InChIKey: CQXQIAAGTRJYPS-UHFFFAOYSA-N.
| Molecular formula | C14H12N4O |
|---|---|
| Molecular weight | 252.27 g/mol |
| IUPAC name | 2-(5-amino-2-pyridinyl)-5-phenyl-4H-pyrazol-3-one |
| InChIKey | CQXQIAAGTRJYPS-UHFFFAOYSA-N |
| SMILES | C1C(=NN(C1=O)C2=NC=C(C=C2)N)C3=CC=CC=C3 |
Computed by PubChem (NCBI)