CAS 1183278-60-5 appears in our catalog under these names: 5-(5-Bromothiophen-2-yl)-1,2,4-triazin-3-amine, 5-(5-Bromothiophen-2-yl)-1,2,4-triazin-3-amine, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 1g, 100mg, 5g.
5-(5-bromothiophen-2-yl)-1,2,4-triazin-3-amine (CAS 1183278-60-5) is a chemical compound with the molecular formula C7H5BrN4S and a molecular weight of 257.11 g/mol. IUPAC name: 5-(5-bromothiophen-2-yl)-1,2,4-triazin-3-amine. InChIKey: WMSQKDLGDKFVIN-UHFFFAOYSA-N.
| Molecular formula | C7H5BrN4S |
|---|---|
| Molecular weight | 257.11 g/mol |
| IUPAC name | 5-(5-bromothiophen-2-yl)-1,2,4-triazin-3-amine |
| InChIKey | WMSQKDLGDKFVIN-UHFFFAOYSA-N |
| SMILES | C1=C(SC(=C1)Br)C2=CN=NC(=N2)N |
Computed by PubChem (NCBI)