CAS 70057-75-9 is the registry number for 5-(5-Bromopyridin-3-yl)-1,3,4-thiadiazol-2-amine, 95%. Offered by: AmBeed. Available pack sizes: 1g.
5-(5-bromo-3-pyridinyl)-1,3,4-thiadiazol-2-amine (CAS 70057-75-9) is a chemical compound with the molecular formula C7H5BrN4S and a molecular weight of 257.11 g/mol. IUPAC name: 5-(5-bromo-3-pyridinyl)-1,3,4-thiadiazol-2-amine. InChIKey: WBMPOMGBOZKUTQ-UHFFFAOYSA-N.
| Molecular formula | C7H5BrN4S |
|---|---|
| Molecular weight | 257.11 g/mol |
| IUPAC name | 5-(5-bromo-3-pyridinyl)-1,3,4-thiadiazol-2-amine |
| InChIKey | WBMPOMGBOZKUTQ-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC=C1Br)C2=NN=C(S2)N |
Computed by PubChem (NCBI)