CAS 26534-61-2 is the registry number for 1-(3-Bromophenyl)-1,2-dihydro-5H-tetrazole-5-thione, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(3-bromophenyl)-2H-tetrazole-5-thione (CAS 26534-61-2) is a chemical compound with the molecular formula C7H5BrN4S and a molecular weight of 257.11 g/mol. IUPAC name: 1-(3-bromophenyl)-2H-tetrazole-5-thione. InChIKey: ZTCSFDWJABQDIC-UHFFFAOYSA-N.
| Molecular formula | C7H5BrN4S |
|---|---|
| Molecular weight | 257.11 g/mol |
| IUPAC name | 1-(3-bromophenyl)-2H-tetrazole-5-thione |
| InChIKey | ZTCSFDWJABQDIC-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Br)N2C(=S)N=NN2 |
Computed by PubChem (NCBI)