CAS 22347-29-1 appears in our catalog under these names: 1-(4-Bromophenyl)-1h-tetrazole-5-thiol, 95%, 1-(4-Bromophenyl)-4,5-dihydro-1H-1,2,3,4-tetrazole-5-thione. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 0,5g, 50mg.
1-(4-bromophenyl)-2H-tetrazole-5-thione (CAS 22347-29-1) is a chemical compound with the molecular formula C7H5BrN4S and a molecular weight of 257.11 g/mol. IUPAC name: 1-(4-bromophenyl)-2H-tetrazole-5-thione. InChIKey: YJRIGYBILBNKPH-UHFFFAOYSA-N.
| Molecular formula | C7H5BrN4S |
|---|---|
| Molecular weight | 257.11 g/mol |
| IUPAC name | 1-(4-bromophenyl)-2H-tetrazole-5-thione |
| InChIKey | YJRIGYBILBNKPH-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1N2C(=S)N=NN2)Br |
Computed by PubChem (NCBI)