CAS 1183376-98-8 appears in our catalog under these names: 1-(2,4-Dichlorophenyl)piperidin-4-amine, 98%, 1-(2,4-Dichlorophenyl)piperidin-4-amine. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
1-(2,4-dichlorophenyl)piperidin-4-amine (CAS 1183376-98-8) is a chemical compound with the molecular formula C11H14Cl2N2 and a molecular weight of 245.14 g/mol. IUPAC name: 1-(2,4-dichlorophenyl)piperidin-4-amine. InChIKey: WQSPQMDXJQLZCQ-UHFFFAOYSA-N.
| Molecular formula | C11H14Cl2N2 |
|---|---|
| Molecular weight | 245.14 g/mol |
| IUPAC name | 1-(2,4-dichlorophenyl)piperidin-4-amine |
| InChIKey | WQSPQMDXJQLZCQ-UHFFFAOYSA-N |
| SMILES | C1CN(CCC1N)C2=C(C=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)