Products 1183419-70-6
CAS 1183419-70-6 is the registry number for N-Cyclopropyl-N-(4,5-dimethylthiophene-2-carbonyl)glycine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-[cyclopropyl-(4,5-dimethylthiophene-2-carbonyl)amino]acetic acid (CAS 1183419-70-6) is a chemical compound with the molecular formula C12H15NO3S and a molecular weight of 253.32 g/mol. IUPAC name: 2-[cyclopropyl-(4,5-dimethylthiophene-2-carbonyl)amino]acetic acid. InChIKey: GEGCKICQOBAUAG-UHFFFAOYSA-N.
| Molecular formula | C12H15NO3S |
|---|---|
| Molecular weight | 253.32 g/mol |
| IUPAC name | 2-[cyclopropyl-(4,5-dimethylthiophene-2-carbonyl)amino]acetic acid |
| InChIKey | GEGCKICQOBAUAG-UHFFFAOYSA-N |
| SMILES | CC1=C(SC(=C1)C(=O)N(CC(=O)O)C2CC2)C |
Computed by PubChem (NCBI)