Products 1183424-11-4
CAS 1183424-11-4 is the registry number for 2-Chloro-5-(2-oxoimidazolidin-1-yl)benzoic acid. Offered by: Biosynth. Available pack sizes: 100mg, 50mg, 250mg, 1000mg, 500mg.
2-chloro-5-(2-oxoimidazolidin-1-yl)benzoic acid (CAS 1183424-11-4) is a chemical compound with the molecular formula C10H9ClN2O3 and a molecular weight of 240.64 g/mol. IUPAC name: 2-chloro-5-(2-oxoimidazolidin-1-yl)benzoic acid. InChIKey: RYLWJXSPVCHJTQ-UHFFFAOYSA-N.
| Molecular formula | C10H9ClN2O3 |
|---|---|
| Molecular weight | 240.64 g/mol |
| IUPAC name | 2-chloro-5-(2-oxoimidazolidin-1-yl)benzoic acid |
| InChIKey | RYLWJXSPVCHJTQ-UHFFFAOYSA-N |
| SMILES | C1CN(C(=O)N1)C2=CC(=C(C=C2)Cl)C(=O)O |
Computed by PubChem (NCBI)