CAS 1183437-92-4 is the registry number for 7-(Chlorosulfonyl)-2,3-dihydro-1H-indene-5-carboxylic acid, 95%. Offered by: AmBeed. Available pack sizes: 5g.
7-chlorosulfonyl-2,3-dihydro-1H-indene-5-carboxylic acid (CAS 1183437-92-4) is a chemical compound with the molecular formula C10H9ClO4S and a molecular weight of 260.69 g/mol. IUPAC name: 7-chlorosulfonyl-2,3-dihydro-1H-indene-5-carboxylic acid. InChIKey: WUAURUXLBQZWSG-UHFFFAOYSA-N.
| Molecular formula | C10H9ClO4S |
|---|---|
| Molecular weight | 260.69 g/mol |
| IUPAC name | 7-chlorosulfonyl-2,3-dihydro-1H-indene-5-carboxylic acid |
| InChIKey | WUAURUXLBQZWSG-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C1)C(=CC(=C2)C(=O)O)S(=O)(=O)Cl |
Computed by PubChem (NCBI)