CAS 909793-64-2 is the registry number for 4-(Chlorosulfonyl)-2,3-dihydro-1H-indene-2-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-chlorosulfonyl-2,3-dihydro-1H-indene-2-carboxylic acid (CAS 909793-64-2) is a chemical compound with the molecular formula C10H9ClO4S and a molecular weight of 260.69 g/mol. IUPAC name: 4-chlorosulfonyl-2,3-dihydro-1H-indene-2-carboxylic acid. InChIKey: ZFYBODNUMSFQLS-UHFFFAOYSA-N.
| Molecular formula | C10H9ClO4S |
|---|---|
| Molecular weight | 260.69 g/mol |
| IUPAC name | 4-chlorosulfonyl-2,3-dihydro-1H-indene-2-carboxylic acid |
| InChIKey | ZFYBODNUMSFQLS-UHFFFAOYSA-N |
| SMILES | C1C(CC2=C1C=CC=C2S(=O)(=O)Cl)C(=O)O |
Computed by PubChem (NCBI)